imported>InternetArchiveBot: Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.8

2021-08-12T18:42:25Z

Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.8

புதிய பக்கம்

{{drugbox
| verifiedrevid = 457117932
| IUPAC_name = (1''r'',2''R'',3''S'',4''r'',5''R'',6''S'')-1,2,3,4,5,6-எக்சாகுளோரோ சைக்குளோயெக்சேன்
| image = Gamma-hexachlorocyclohexane.svg
| width = 150px


| Drugs.com =
| MedlinePlus = a682651
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category = C
| legal_AU = 
| legal_UK = 
| legal_US = 
| legal_status = 169 [[நாடுகள்|நாடுகளில்]] இதை தயாரிப்பதையும், [[விவசாயம்|விவசாயத்திற்குப்]] பயன்படுத்துவதையும் தடை செய்துள்ளார்கள். ஆனால், [[மருந்து|மருந்தாக]] 2015-வரை உபயோகப்படுத்த அனுமதித்துள்ளார்கள்<ref>Report of the Conference of the Parties of the Stockholm Convention on Persistent Organic Pollutants on the work of its fourth meeting. Convention on Persistent Organic Pollutants. Fourth meeting, Geneva, 4–8 May 2009. [http://chm.pops.int/Portals/0/Repository/COP4/UNEP-POPS-COP.4-38.English.pdf http://chm.pops.int/Portals/0/Repository/COP4/UNEP-POPS-COP.4-38.English.pdf]</ref>
| routes_of_administration = புற மருந்தாக (மேல் பூச்சு)


| bioavailability =
| protein_bound = 91%
| metabolism = [[ஈரல்]] வழி
| elimination_half-life = 18 மணிநேரம்
| excretion =


| CASNo_Ref =
| CAS_number_Ref =
| CAS_number = 58-89-9
| ATC_prefix = P03
| ATC_suffix = AB02
| ATC_supplemental = {{ATCvet|P53|AB02}} {{ATCvet|S02|QA01}}
| PubChem = 727
| DrugBank_Ref =
| DrugBank = DB00431
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10481896
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 59NEE7PCAB
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C07075
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32888
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 15891


| C=6 | H=6 | Cl=6
| molecular_weight = 290.83 கி/மோல்
| smiles = Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl
| InChI = 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+
| InChIKey = JLYXXMFPNIAWKQ-GNIYUCBRSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JLYXXMFPNIAWKQ-GNIYUCBRSA-N
}}

'''லின்டேன்''' (Lindane), '''காமா எக்சாகுளோரோ சைக்குளோயெக்சேன்''' (γ-HCH), '''காமாசேன்''' (gammaxene), '''காமாலின்''' (Gammallin) என்றும், தவறாக '''[[பென்சீன்]] எக்சாகுளோரைடு''' என்றும் (BHC) அழைக்கப்படுகிறது<ref name="bhc-misnomer">{{cite book |title= Analytical toxicology: for clinical, forensic, and pharmaceutical chemists |last1= Brandenberger |first1= Hans |last2= Maes |first2= Robert A. A. |year= 1997 |publisher= Walter de Gruyter |location= Berlin |isbn= 978-3-11-010731-9 |page= 243 |url= http://books.google.com/?id=ZhYtynyC4kAC&pg=PA243&lpg=PA243 |accessdate= 2009-05-10}}</ref>. [[கரிமம்|கரிமக்]][[குளோரின்|குளோரினான]] (organochlorine) லின்டேன் எக்சாகுளோரோ சைக்குளோயெக்சேனின் [[வேதியியல்|வேதித்]]திரிபாகும். இது [[விவசாயம்|விவசாயத்தில்]] [[பூச்சிக்கொல்லி|பூச்சிக்கொல்லியாகவும்]], [[பேன்]] வகை [[ஒட்டுண்ணி|ஒட்டுண்ணிகள்]], [[சொறி]] சிரங்கு (அளவன்) ஆகியவற்றுக்கு [[மருந்து|மருந்தாகவும்]] பயன்படுத்தப்படுகிறது<ref name="drugs.com">[http://www.drugs.com/mmx/lindane.html Drugs.com Professional Drug Information: Lindane]. Retrieved 2009-05-10</ref><ref name="x4">Commission for Environmental Cooperation. The North American Regional Action Plan (NARAP) on Lindane and Other Hexachlorocyclohexane (HCH) Isomers. 2005. Available at: http://www.cec.org/files/PDF/POLLUTANTS/Lindane-NARAP-Public-Comment_en.pdf {{Webarchive|url=https://web.archive.org/web/20150923201519/http://www.cec.org/files/PDF/POLLUTANTS/Lindane-NARAP-Public-Comment_en.pdf |date=2015-09-23 }}.</ref>.

<gallery>
File:Alpha-hexachlorocyclohexane.svg|ஆல்ஃபா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Beta-hexachlorocyclohexane.svg| பீட்டா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Gamma-hexachlorocyclohexane.svg|லின்டேன் முப்பரிமாண வடிவம்
File:Delta-hexachlorocyclohexane.svg|டெல்டா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Epsilon-hexachlorocyclohexane.svg|எப்சிலான்-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Eta-hexachlorocyclohexane.svg|ஈட்டா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Theta-hexachlorocyclohexane.svg|தீட்டா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
File:Zeta-hexachlorocyclohexane.svg|ஜீட்டா-எக்சாகுளோரோ சைக்குளோயெக்சேன்
</gallery>

==மேற்கோள்கள்==
{{Reflist}}

[[பகுப்பு:மருந்துகள்]]
[[பகுப்பு:கரிமகுளோரைடு பூச்சிக்கொல்லிகள்]]

லின்டேன் - திருத்த வரலாறு

imported>InternetArchiveBot: Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.8